C17H24N4O4 — CID 168533377
2-[4-[(carbamoylhydrazinylidene)methyl]-2-methoxyphenoxy]-N-cyclohexylacetamide (PubChem CID 168533377) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-[4-[(carbamoylhydrazinylidene)methyl]-2-methoxyphenoxy]-N-cyclohexylacetamide.
| Compound Name | 2-[4-[(carbamoylhydrazinylidene)methyl]-2-methoxyphenoxy]-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 168533377 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 2-[4-[(carbamoylhydrazinylidene)methyl]-2-methoxyphenoxy]-N-cyclohexylacetamide |
| SMILES | COc1cc(C=NNC(N)=O)ccc1OCC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H24N4O4/c1-24-15-9-12(10-19-21-17(18)23)7-8-14(15)25-11-16(22)20-13-5-3-2-4-6-13/h7-10,13H,2-6,11H2,1H3,(H,20,22)(H3,18,21,23) |
| InChIKey | OYKGNHOFZQEKQK-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|