C17H23BrN4O4 — CID 168533387
2-[2-bromo-4-[(carbamoylhydrazinylidene)methyl]-6-methoxyphenoxy]-N-cyclohexylacetamide (PubChem CID 168533387) has the molecular formula C17H23BrN4O4 and a molecular weight of 427.30 g/mol. Its IUPAC name is 2-[2-bromo-4-[(carbamoylhydrazinylidene)methyl]-6-methoxyphenoxy]-N-cyclohexylacetamide.
| Compound Name | 2-[2-bromo-4-[(carbamoylhydrazinylidene)methyl]-6-methoxyphenoxy]-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 168533387 |
| Molecular Formula | C17H23BrN4O4 |
| Molecular Weight | 427.30 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 2-[2-bromo-4-[(carbamoylhydrazinylidene)methyl]-6-methoxyphenoxy]-N-cyclohexylacetamide |
| SMILES | COc1cc(C=NNC(N)=O)cc(Br)c1OCC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H23BrN4O4/c1-25-14-8-11(9-20-22-17(19)24)7-13(18)16(14)26-10-15(23)21-12-5-3-2-4-6-12/h7-9,12H,2-6,10H2,1H3,(H,21,23)(H3,19,22,24) |
| InChIKey | RJMSZMJLEWPGAJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|