C13H12BrN3O5 — CID 40553322
2-[2-bromo-4-[(Z)-[(2-cyanoacetyl)hydrazinylidene]methyl]-6-methoxyphenoxy]acetic acid (PubChem CID 40553322) has the molecular formula C13H12BrN3O5 and a molecular weight of 370.16 g/mol. Its IUPAC name is 2-[2-bromo-4-[(Z)-[(2-cyanoacetyl)hydrazinylidene]methyl]-6-methoxyphenoxy]acetic acid.
| Compound Name | 2-[2-bromo-4-[(Z)-[(2-cyanoacetyl)hydrazinylidene]methyl]-6-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 40553322 |
| Molecular Formula | C13H12BrN3O5 |
| Molecular Weight | 370.16 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | 2-[2-bromo-4-[(Z)-[(2-cyanoacetyl)hydrazinylidene]methyl]-6-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(/C=N\NC(=O)CC#N)cc(Br)c1OCC(=O)O |
| InChI | InChI=1S/C13H12BrN3O5/c1-21-10-5-8(6-16-17-11(18)2-3-15)4-9(14)13(10)22-7-12(19)20/h4-6H,2,7H2,1H3,(H,17,18)(H,19,20)/b16-6- |
| InChIKey | OMWCIPYBHHNJQU-SOFYXZRVSA-N |
| XLogP | 1.28 |
| TPSA | 121.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.16 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|