C22H24BrN3O7 — CID 126010842
2-[2-bromo-4-[(Z)-[[(3R)-3-(ethoxycarbonylamino)-3-phenylpropanoyl]hydrazinylidene]methyl]-6-methoxyphenoxy]acetic acid (PubChem CID 126010842) has the molecular formula C22H24BrN3O7 and a molecular weight of 522.35 g/mol. Its IUPAC name is 2-[2-bromo-4-[(Z)-[[(3R)-3-(ethoxycarbonylamino)-3-phenylpropanoyl]hydrazinylidene]methyl]-6-methoxyphenoxy]acetic acid.
| Compound Name | 2-[2-bromo-4-[(Z)-[[(3R)-3-(ethoxycarbonylamino)-3-phenylpropanoyl]hydrazinylidene]methyl]-6-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 126010842 |
| Molecular Formula | C22H24BrN3O7 |
| Molecular Weight | 522.35 g/mol |
| Exact Mass | 521.08 |
| IUPAC Name | 2-[2-bromo-4-[(Z)-[[(3R)-3-(ethoxycarbonylamino)-3-phenylpropanoyl]hydrazinylidene]methyl]-6-methoxyphenoxy]acetic acid |
| SMILES | CCOC(=O)N[C@H](CC(=O)N/N=C\c1cc(Br)c(OCC(=O)O)c(OC)c1)c1ccccc1 |
| InChI | InChI=1S/C22H24BrN3O7/c1-3-32-22(30)25-17(15-7-5-4-6-8-15)11-19(27)26-24-12-14-9-16(23)21(18(10-14)31-2)33-13-20(28)29/h4-10,12,17H,3,11,13H2,1-2H3,(H,25,30)(H,26,27)(H,28,29)/b24-12-/t17-/m1/s1 |
| InChIKey | XAPRIVRNFBHNER-SAMUYDCASA-N |
| XLogP | 3.25 |
| TPSA | 135.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|