C24H26ClN3O5 — CID 126009525
ethyl N-[(1R)-3-[(2Z)-2-[(3-chloro-5-ethoxy-4-prop-2-ynoxyphenyl)methylidene]hydrazinyl]-3-oxo-1-phenylpropyl]carbamate (PubChem CID 126009525) has the molecular formula C24H26ClN3O5 and a molecular weight of 471.94 g/mol. Its IUPAC name is ethyl N-[(1R)-3-[(2Z)-2-[(3-chloro-5-ethoxy-4-prop-2-ynoxyphenyl)methylidene]hydrazinyl]-3-oxo-1-phenylpropyl]carbamate.
| Compound Name | ethyl N-[(1R)-3-[(2Z)-2-[(3-chloro-5-ethoxy-4-prop-2-ynoxyphenyl)methylidene]hydrazinyl]-3-oxo-1-phenylpropyl]carbamate |
|---|---|
| PubChem CID | 126009525 |
| Molecular Formula | C24H26ClN3O5 |
| Molecular Weight | 471.94 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | ethyl N-[(1R)-3-[(2Z)-2-[(3-chloro-5-ethoxy-4-prop-2-ynoxyphenyl)methylidene]hydrazinyl]-3-oxo-1-phenylpropyl]carbamate |
| SMILES | C#CCOc1c(Cl)cc(/C=N\NC(=O)C[C@@H](NC(=O)OCC)c2ccccc2)cc1OCC |
| InChI | InChI=1S/C24H26ClN3O5/c1-4-12-33-23-19(25)13-17(14-21(23)31-5-2)16-26-28-22(29)15-20(27-24(30)32-6-3)18-10-8-7-9-11-18/h1,7-11,13-14,16,20H,5-6,12,15H2,2-3H3,(H,27,30)(H,28,29)/b26-16-/t20-/m1/s1 |
| InChIKey | QDGKOXKHIVHLQP-WWAUWJAYSA-N |
| XLogP | 4.08 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.94 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|