C32H31Cl2N3O5S — CID 126005845
(3R)-N-[(Z)-[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide (PubChem CID 126005845) has the molecular formula C32H31Cl2N3O5S and a molecular weight of 640.59 g/mol. Its IUPAC name is (3R)-N-[(Z)-[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide.
| Compound Name | (3R)-N-[(Z)-[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 126005845 |
| Molecular Formula | C32H31Cl2N3O5S |
| Molecular Weight | 640.59 g/mol |
| Exact Mass | 639.14 |
| IUPAC Name | (3R)-N-[(Z)-[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C[C@@H](NS(=O)(=O)c2ccc(C)cc2)c2ccccc2)cc(Cl)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H31Cl2N3O5S/c1-3-41-30-18-24(17-28(34)32(30)42-21-23-11-13-26(33)14-12-23)20-35-36-31(38)19-29(25-7-5-4-6-8-25)37-43(39,40)27-15-9-22(2)10-16-27/h4-18,20,29,37H,3,19,21H2,1-2H3,(H,36,38)/b35-20-/t29-/m1/s1 |
| InChIKey | QCXLGXNMDIXDBA-VJVCGNSCSA-N |
| XLogP | 6.84 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.59 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|