C27H29IN4O6S — CID 126006070
(3S)-N-[(Z)-[4-(2-amino-2-oxoethoxy)-3-ethoxy-5-iodophenyl]methylideneamino]-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide (PubChem CID 126006070) has the molecular formula C27H29IN4O6S and a molecular weight of 664.52 g/mol. Its IUPAC name is (3S)-N-[(Z)-[4-(2-amino-2-oxoethoxy)-3-ethoxy-5-iodophenyl]methylideneamino]-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide.
| Compound Name | (3S)-N-[(Z)-[4-(2-amino-2-oxoethoxy)-3-ethoxy-5-iodophenyl]methylideneamino]-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 126006070 |
| Molecular Formula | C27H29IN4O6S |
| Molecular Weight | 664.52 g/mol |
| Exact Mass | 664.09 |
| IUPAC Name | (3S)-N-[(Z)-[4-(2-amino-2-oxoethoxy)-3-ethoxy-5-iodophenyl]methylideneamino]-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C[C@H](NS(=O)(=O)c2ccc(C)cc2)c2ccccc2)cc(I)c1OCC(N)=O |
| InChI | InChI=1S/C27H29IN4O6S/c1-3-37-24-14-19(13-22(28)27(24)38-17-25(29)33)16-30-31-26(34)15-23(20-7-5-4-6-8-20)32-39(35,36)21-11-9-18(2)10-12-21/h4-14,16,23,32H,3,15,17H2,1-2H3,(H2,29,33)(H,31,34)/b30-16-/t23-/m0/s1 |
| InChIKey | CXASUFHVNAQUQZ-NORXXVMPSA-N |
| XLogP | 3.42 |
| TPSA | 149.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|