C23H22BrN3O4S — CID 135905622
(3S)-N-[(Z)-(3-bromo-4-hydroxyphenyl)methylideneamino]-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide (PubChem CID 135905622) has the molecular formula C23H22BrN3O4S and a molecular weight of 516.42 g/mol. Its IUPAC name is (3S)-N-[(Z)-(3-bromo-4-hydroxyphenyl)methylideneamino]-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide.
| Compound Name | (3S)-N-[(Z)-(3-bromo-4-hydroxyphenyl)methylideneamino]-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 135905622 |
| Molecular Formula | C23H22BrN3O4S |
| Molecular Weight | 516.42 g/mol |
| Exact Mass | 515.05 |
| IUPAC Name | (3S)-N-[(Z)-(3-bromo-4-hydroxyphenyl)methylideneamino]-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](CC(=O)N/N=C\c2ccc(O)c(Br)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H22BrN3O4S/c1-16-7-10-19(11-8-16)32(30,31)27-21(18-5-3-2-4-6-18)14-23(29)26-25-15-17-9-12-22(28)20(24)13-17/h2-13,15,21,27-28H,14H2,1H3,(H,26,29)/b25-15-/t21-/m0/s1 |
| InChIKey | KLGVQXCKLJFTOY-BABSMXRMSA-N |
| XLogP | 4.02 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|