C24H23Br2N3O5S — CID 137127509
(3S)-N-[(Z)-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide (PubChem CID 137127509) has the molecular formula C24H23Br2N3O5S and a molecular weight of 625.34 g/mol. Its IUPAC name is (3S)-N-[(Z)-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide.
| Compound Name | (3S)-N-[(Z)-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 137127509 |
| Molecular Formula | C24H23Br2N3O5S |
| Molecular Weight | 625.34 g/mol |
| Exact Mass | 622.97 |
| IUPAC Name | (3S)-N-[(Z)-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide |
| SMILES | COc1cc(/C=N\NC(=O)C[C@H](NS(=O)(=O)c2ccc(C)cc2)c2ccccc2)c(Br)c(Br)c1O |
| InChI | InChI=1S/C24H23Br2N3O5S/c1-15-8-10-18(11-9-15)35(32,33)29-19(16-6-4-3-5-7-16)13-21(30)28-27-14-17-12-20(34-2)24(31)23(26)22(17)25/h3-12,14,19,29,31H,13H2,1-2H3,(H,28,30)/b27-14-/t19-/m0/s1 |
| InChIKey | QOUHDOMCQYFIIF-QUNIRZABSA-N |
| XLogP | 4.79 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.34 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|