C24H21Br2N3O4 — CID 137127342
N-[(1S)-3-[(2Z)-2-[(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-3-oxo-1-phenylpropyl]benzamide (PubChem CID 137127342) has the molecular formula C24H21Br2N3O4 and a molecular weight of 575.26 g/mol. Its IUPAC name is N-[(1S)-3-[(2Z)-2-[(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-3-oxo-1-phenylpropyl]benzamide.
| Compound Name | N-[(1S)-3-[(2Z)-2-[(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-3-oxo-1-phenylpropyl]benzamide |
|---|---|
| PubChem CID | 137127342 |
| Molecular Formula | C24H21Br2N3O4 |
| Molecular Weight | 575.26 g/mol |
| Exact Mass | 572.99 |
| IUPAC Name | N-[(1S)-3-[(2Z)-2-[(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-3-oxo-1-phenylpropyl]benzamide |
| SMILES | COc1cc(/C=N\NC(=O)C[C@H](NC(=O)c2ccccc2)c2ccccc2)c(Br)c(Br)c1O |
| InChI | InChI=1S/C24H21Br2N3O4/c1-33-19-12-17(21(25)22(26)23(19)31)14-27-29-20(30)13-18(15-8-4-2-5-9-15)28-24(32)16-10-6-3-7-11-16/h2-12,14,18,31H,13H2,1H3,(H,28,32)(H,29,30)/b27-14-/t18-/m0/s1 |
| InChIKey | BNOCDVJPKLBNPA-RDEZCIGGSA-N |
| XLogP | 4.94 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.26 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|