C17H16Br2N2O4 — CID 136816629
(2R)-N-[(Z)-(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-hydroxy-2-phenylacetamide (PubChem CID 136816629) has the molecular formula C17H16Br2N2O4 and a molecular weight of 472.13 g/mol. Its IUPAC name is (2R)-N-[(Z)-(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-hydroxy-2-phenylacetamide.
| Compound Name | (2R)-N-[(Z)-(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 136816629 |
| Molecular Formula | C17H16Br2N2O4 |
| Molecular Weight | 472.13 g/mol |
| Exact Mass | 469.95 |
| IUPAC Name | (2R)-N-[(Z)-(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-hydroxy-2-phenylacetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)[C@H](O)c2ccccc2)c(Br)c(Br)c1O |
| InChI | InChI=1S/C17H16Br2N2O4/c1-2-25-12-8-11(13(18)14(19)16(12)23)9-20-21-17(24)15(22)10-6-4-3-5-7-10/h3-9,15,22-23H,2H2,1H3,(H,21,24)/b20-9-/t15-/m1/s1 |
| InChIKey | HIBOINDFHSMCHC-WJHPISCYSA-N |
| XLogP | 3.50 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.13 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|