C19H22N2O4 — CID 126272234
(2R)-N-[(Z)-(2,4-diethoxyphenyl)methylideneamino]-2-hydroxy-2-phenylacetamide (PubChem CID 126272234) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is (2R)-N-[(Z)-(2,4-diethoxyphenyl)methylideneamino]-2-hydroxy-2-phenylacetamide.
| Compound Name | (2R)-N-[(Z)-(2,4-diethoxyphenyl)methylideneamino]-2-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 126272234 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | (2R)-N-[(Z)-(2,4-diethoxyphenyl)methylideneamino]-2-hydroxy-2-phenylacetamide |
| SMILES | CCOc1ccc(/C=N\NC(=O)[C@H](O)c2ccccc2)c(OCC)c1 |
| InChI | InChI=1S/C19H22N2O4/c1-3-24-16-11-10-15(17(12-16)25-4-2)13-20-21-19(23)18(22)14-8-6-5-7-9-14/h5-13,18,22H,3-4H2,1-2H3,(H,21,23)/b20-13-/t18-/m1/s1 |
| InChIKey | WANPQXPSUNLEPX-RXWSAZGZSA-N |
| XLogP | 2.67 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|