C18H14Br2N2O4 — CID 137162400
N-[(E)-(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 137162400) has the molecular formula C18H14Br2N2O4 and a molecular weight of 482.13 g/mol. Its IUPAC name is N-[(E)-(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | N-[(E)-(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 137162400 |
| Molecular Formula | C18H14Br2N2O4 |
| Molecular Weight | 482.13 g/mol |
| Exact Mass | 479.93 |
| IUPAC Name | N-[(E)-(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2cc3ccccc3o2)c(Br)c(Br)c1O |
| InChI | InChI=1S/C18H14Br2N2O4/c1-2-25-13-8-11(15(19)16(20)17(13)23)9-21-22-18(24)14-7-10-5-3-4-6-12(10)26-14/h3-9,23H,2H2,1H3,(H,22,24)/b21-9+ |
| InChIKey | XUEQYMNXDAAZMX-ZVBGSRNCSA-N |
| XLogP | 4.83 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.13 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|