C18H19Br2N3O4 — CID 135489011
N-[(Z)-(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-(2-methoxyanilino)acetamide (PubChem CID 135489011) has the molecular formula C18H19Br2N3O4 and a molecular weight of 501.18 g/mol. Its IUPAC name is N-[(Z)-(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-(2-methoxyanilino)acetamide.
| Compound Name | N-[(Z)-(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-(2-methoxyanilino)acetamide |
|---|---|
| PubChem CID | 135489011 |
| Molecular Formula | C18H19Br2N3O4 |
| Molecular Weight | 501.18 g/mol |
| Exact Mass | 498.97 |
| IUPAC Name | N-[(Z)-(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-(2-methoxyanilino)acetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)CNc2ccccc2OC)c(Br)c(Br)c1O |
| InChI | InChI=1S/C18H19Br2N3O4/c1-3-27-14-8-11(16(19)17(20)18(14)25)9-22-23-15(24)10-21-12-6-4-5-7-13(12)26-2/h4-9,21,25H,3,10H2,1-2H3,(H,23,24)/b22-9- |
| InChIKey | LTPUDBYJVGLCAP-AFPJDJCSSA-N |
| XLogP | 3.89 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.18 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|