C17H17BrN2O4 — CID 126270849
(2S)-N-[(Z)-(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-2-hydroxy-2-phenylacetamide (PubChem CID 126270849) has the molecular formula C17H17BrN2O4 and a molecular weight of 393.24 g/mol. Its IUPAC name is (2S)-N-[(Z)-(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-2-hydroxy-2-phenylacetamide.
| Compound Name | (2S)-N-[(Z)-(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-2-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 126270849 |
| Molecular Formula | C17H17BrN2O4 |
| Molecular Weight | 393.24 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | (2S)-N-[(Z)-(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-2-hydroxy-2-phenylacetamide |
| SMILES | COc1cc(OC)c(/C=N\NC(=O)[C@@H](O)c2ccccc2)cc1Br |
| InChI | InChI=1S/C17H17BrN2O4/c1-23-14-9-15(24-2)13(18)8-12(14)10-19-20-17(22)16(21)11-6-4-3-5-7-11/h3-10,16,21H,1-2H3,(H,20,22)/b19-10-/t16-/m0/s1 |
| InChIKey | PBVPNPBPLSDWRS-WSLMLHKMSA-N |
| XLogP | 2.65 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|