C19H19Br2N3O4 — CID 3901967
2-bromo-N-[1-[2-[(5-bromo-2,4-dimethoxyphenyl)methylidene]hydrazinyl]-1-oxopropan-2-yl]benzamide (PubChem CID 3901967) has the molecular formula C19H19Br2N3O4 and a molecular weight of 513.19 g/mol. Its IUPAC name is 2-bromo-N-[1-[2-[(5-bromo-2,4-dimethoxyphenyl)methylidene]hydrazinyl]-1-oxopropan-2-yl]benzamide.
| Compound Name | 2-bromo-N-[1-[2-[(5-bromo-2,4-dimethoxyphenyl)methylidene]hydrazinyl]-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 3901967 |
| Molecular Formula | C19H19Br2N3O4 |
| Molecular Weight | 513.19 g/mol |
| Exact Mass | 510.97 |
| IUPAC Name | 2-bromo-N-[1-[2-[(5-bromo-2,4-dimethoxyphenyl)methylidene]hydrazinyl]-1-oxopropan-2-yl]benzamide |
| SMILES | COc1cc(OC)c(C=NNC(=O)C(C)NC(=O)c2ccccc2Br)cc1Br |
| InChI | InChI=1S/C19H19Br2N3O4/c1-11(23-19(26)13-6-4-5-7-14(13)20)18(25)24-22-10-12-8-15(21)17(28-3)9-16(12)27-2/h4-11H,1-3H3,(H,23,26)(H,24,25) |
| InChIKey | CPRMODSXGRGBPT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.19 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|