C14H12Br2N2O3S — CID 135684249
N-[(E)-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-thiophen-2-ylacetamide (PubChem CID 135684249) has the molecular formula C14H12Br2N2O3S and a molecular weight of 448.14 g/mol. Its IUPAC name is N-[(E)-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-thiophen-2-ylacetamide.
| Compound Name | N-[(E)-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 135684249 |
| Molecular Formula | C14H12Br2N2O3S |
| Molecular Weight | 448.14 g/mol |
| Exact Mass | 445.89 |
| IUPAC Name | N-[(E)-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-thiophen-2-ylacetamide |
| SMILES | COc1cc(/C=N/NC(=O)Cc2cccs2)c(Br)c(Br)c1O |
| InChI | InChI=1S/C14H12Br2N2O3S/c1-21-10-5-8(12(15)13(16)14(10)20)7-17-18-11(19)6-9-3-2-4-22-9/h2-5,7,20H,6H2,1H3,(H,18,19)/b17-7+ |
| InChIKey | XQMZARFIPNGMJT-REZTVBANSA-N |
| XLogP | 3.68 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.14 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|