C14H17Br2N3O4 — CID 135905102
N-[(Z)-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-morpholin-4-ylacetamide (PubChem CID 135905102) has the molecular formula C14H17Br2N3O4 and a molecular weight of 451.12 g/mol. Its IUPAC name is N-[(Z)-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-morpholin-4-ylacetamide.
| Compound Name | N-[(Z)-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 135905102 |
| Molecular Formula | C14H17Br2N3O4 |
| Molecular Weight | 451.12 g/mol |
| Exact Mass | 448.96 |
| IUPAC Name | N-[(Z)-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-morpholin-4-ylacetamide |
| SMILES | COc1cc(/C=N\NC(=O)CN2CCOCC2)c(Br)c(Br)c1O |
| InChI | InChI=1S/C14H17Br2N3O4/c1-22-10-6-9(12(15)13(16)14(10)21)7-17-18-11(20)8-19-2-4-23-5-3-19/h6-7,21H,2-5,8H2,1H3,(H,18,20)/b17-7- |
| InChIKey | UKCFDSWXOLEKCC-IDUWFGFVSA-N |
| XLogP | 1.71 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.12 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|