C15H20N4O6 — CID 5344300
N-[(E)-(4,5-dimethoxy-2-nitrophenyl)methylideneamino]-2-morpholin-4-ylacetamide (PubChem CID 5344300) has the molecular formula C15H20N4O6 and a molecular weight of 352.35 g/mol. Its IUPAC name is N-[(E)-(4,5-dimethoxy-2-nitrophenyl)methylideneamino]-2-morpholin-4-ylacetamide.
| Compound Name | N-[(E)-(4,5-dimethoxy-2-nitrophenyl)methylideneamino]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 5344300 |
| Molecular Formula | C15H20N4O6 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | N-[(E)-(4,5-dimethoxy-2-nitrophenyl)methylideneamino]-2-morpholin-4-ylacetamide |
| SMILES | COc1cc(/C=N/NC(=O)CN2CCOCC2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C15H20N4O6/c1-23-13-7-11(12(19(21)22)8-14(13)24-2)9-16-17-15(20)10-18-3-5-25-6-4-18/h7-9H,3-6,10H2,1-2H3,(H,17,20)/b16-9+ |
| InChIKey | QZCDQRCBALHRIK-CXUHLZMHSA-N |
| XLogP | 0.39 |
| TPSA | 115.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|