C14H12Br2N2O2S — CID 92699107
N-[(Z)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-2-thiophen-2-ylacetamide (PubChem CID 92699107) has the molecular formula C14H12Br2N2O2S and a molecular weight of 432.14 g/mol. Its IUPAC name is N-[(Z)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-2-thiophen-2-ylacetamide.
| Compound Name | N-[(Z)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 92699107 |
| Molecular Formula | C14H12Br2N2O2S |
| Molecular Weight | 432.14 g/mol |
| Exact Mass | 429.90 |
| IUPAC Name | N-[(Z)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-2-thiophen-2-ylacetamide |
| SMILES | COc1c(Br)cc(Br)cc1/C=N\NC(=O)Cc1cccs1 |
| InChI | InChI=1S/C14H12Br2N2O2S/c1-20-14-9(5-10(15)6-12(14)16)8-17-18-13(19)7-11-3-2-4-21-11/h2-6,8H,7H2,1H3,(H,18,19)/b17-8- |
| InChIKey | BATKJKCMIMMJOB-IUXPMGMMSA-N |
| XLogP | 3.97 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.14 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|