C26H26BrN3O4S — CID 126009334
(3R)-N-[(Z)-(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide (PubChem CID 126009334) has the molecular formula C26H26BrN3O4S and a molecular weight of 556.48 g/mol. Its IUPAC name is (3R)-N-[(Z)-(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide.
| Compound Name | (3R)-N-[(Z)-(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 126009334 |
| Molecular Formula | C26H26BrN3O4S |
| Molecular Weight | 556.48 g/mol |
| Exact Mass | 555.08 |
| IUPAC Name | (3R)-N-[(Z)-(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide |
| SMILES | C=CCOc1ccc(Br)cc1/C=N\NC(=O)C[C@@H](NS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H26BrN3O4S/c1-3-15-34-25-14-11-22(27)16-21(25)18-28-29-26(31)17-24(20-7-5-4-6-8-20)30-35(32,33)23-12-9-19(2)10-13-23/h3-14,16,18,24,30H,1,15,17H2,2H3,(H,29,31)/b28-18-/t24-/m1/s1 |
| InChIKey | PGLCKYCVTLJSHE-IVRBHCBNSA-N |
| XLogP | 4.88 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.48 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|