C27H26BrN3O5S — CID 126008018
(3R)-N-[(Z)-(5-bromo-3-methoxy-2-prop-2-ynoxyphenyl)methylideneamino]-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide (PubChem CID 126008018) has the molecular formula C27H26BrN3O5S and a molecular weight of 584.49 g/mol. Its IUPAC name is (3R)-N-[(Z)-(5-bromo-3-methoxy-2-prop-2-ynoxyphenyl)methylideneamino]-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide.
| Compound Name | (3R)-N-[(Z)-(5-bromo-3-methoxy-2-prop-2-ynoxyphenyl)methylideneamino]-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 126008018 |
| Molecular Formula | C27H26BrN3O5S |
| Molecular Weight | 584.49 g/mol |
| Exact Mass | 583.08 |
| IUPAC Name | (3R)-N-[(Z)-(5-bromo-3-methoxy-2-prop-2-ynoxyphenyl)methylideneamino]-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide |
| SMILES | C#CCOc1c(/C=N\NC(=O)C[C@@H](NS(=O)(=O)c2ccc(C)cc2)c2ccccc2)cc(Br)cc1OC |
| InChI | InChI=1S/C27H26BrN3O5S/c1-4-14-36-27-21(15-22(28)16-25(27)35-3)18-29-30-26(32)17-24(20-8-6-5-7-9-20)31-37(33,34)23-12-10-19(2)11-13-23/h1,5-13,15-16,18,24,31H,14,17H2,2-3H3,(H,30,32)/b29-18-/t24-/m1/s1 |
| InChIKey | IERCQEQDWGXVMP-APYOZOMWSA-N |
| XLogP | 4.34 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.49 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|