C26H26N4O3S — CID 137127465
(3R)-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide (PubChem CID 137127465) has the molecular formula C26H26N4O3S and a molecular weight of 474.59 g/mol. Its IUPAC name is (3R)-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide.
| Compound Name | (3R)-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 137127465 |
| Molecular Formula | C26H26N4O3S |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | (3R)-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](CC(=O)N/N=C\c2c(C)[nH]c3ccccc23)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H26N4O3S/c1-18-12-14-21(15-13-18)34(32,33)30-25(20-8-4-3-5-9-20)16-26(31)29-27-17-23-19(2)28-24-11-7-6-10-22(23)24/h3-15,17,25,28,30H,16H2,1-2H3,(H,29,31)/b27-17-/t25-/m1/s1 |
| InChIKey | MMJYVVRSTUKDJR-GKZBKZLQSA-N |
| XLogP | 4.34 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|