C32H28Cl2N4O3S — CID 126010253
(3S)-N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide (PubChem CID 126010253) has the molecular formula C32H28Cl2N4O3S and a molecular weight of 619.57 g/mol. Its IUPAC name is (3S)-N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide.
| Compound Name | (3S)-N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 126010253 |
| Molecular Formula | C32H28Cl2N4O3S |
| Molecular Weight | 619.57 g/mol |
| Exact Mass | 618.13 |
| IUPAC Name | (3S)-N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](CC(=O)N/N=C\c2cn(Cc3ccc(Cl)cc3Cl)c3ccccc23)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H28Cl2N4O3S/c1-22-11-15-27(16-12-22)42(40,41)37-30(23-7-3-2-4-8-23)18-32(39)36-35-19-25-21-38(31-10-6-5-9-28(25)31)20-24-13-14-26(33)17-29(24)34/h2-17,19,21,30,37H,18,20H2,1H3,(H,36,39)/b35-19-/t30-/m0/s1 |
| InChIKey | TYUROEIAENVNMW-PQBLXZNQSA-N |
| XLogP | 6.86 |
| TPSA | 92.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.57 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|