C28H21Cl2N3OS — CID 5075051
N-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-2-naphthalen-1-ylsulfanylacetamide (PubChem CID 5075051) has the molecular formula C28H21Cl2N3OS and a molecular weight of 518.47 g/mol. Its IUPAC name is N-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-2-naphthalen-1-ylsulfanylacetamide.
| Compound Name | N-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-2-naphthalen-1-ylsulfanylacetamide |
|---|---|
| PubChem CID | 5075051 |
| Molecular Formula | C28H21Cl2N3OS |
| Molecular Weight | 518.47 g/mol |
| Exact Mass | 517.08 |
| IUPAC Name | N-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-2-naphthalen-1-ylsulfanylacetamide |
| SMILES | O=C(CSc1cccc2ccccc12)NN=Cc1cn(Cc2ccc(Cl)cc2Cl)c2ccccc12 |
| InChI | InChI=1S/C28H21Cl2N3OS/c29-22-13-12-20(25(30)14-22)16-33-17-21(23-8-3-4-10-26(23)33)15-31-32-28(34)18-35-27-11-5-7-19-6-1-2-9-24(19)27/h1-15,17H,16,18H2,(H,32,34) |
| InChIKey | MPRPLMPRIGIYCH-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.47 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|