C19H14Cl2N6O2 — CID 1360529
4-amino-N-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide (PubChem CID 1360529) has the molecular formula C19H14Cl2N6O2 and a molecular weight of 429.27 g/mol. Its IUPAC name is 4-amino-N-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | 4-amino-N-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 1360529 |
| Molecular Formula | C19H14Cl2N6O2 |
| Molecular Weight | 429.27 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 4-amino-N-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
| SMILES | Nc1nonc1C(=O)NN=Cc1cn(Cc2ccc(Cl)cc2Cl)c2ccccc12 |
| InChI | InChI=1S/C19H14Cl2N6O2/c20-13-6-5-11(15(21)7-13)9-27-10-12(14-3-1-2-4-16(14)27)8-23-24-19(28)17-18(22)26-29-25-17/h1-8,10H,9H2,(H2,22,26)(H,24,28) |
| InChIKey | ZCOBLSBOOLEYBD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 111.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.27 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|