C20H15Cl2N5O2 — CID 58523948
N-[(E)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-4-methyl-1,2,5-oxadiazole-3-carboxamide (PubChem CID 58523948) has the molecular formula C20H15Cl2N5O2 and a molecular weight of 428.28 g/mol. Its IUPAC name is N-[(E)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-4-methyl-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | N-[(E)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-4-methyl-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 58523948 |
| Molecular Formula | C20H15Cl2N5O2 |
| Molecular Weight | 428.28 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | N-[(E)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-4-methyl-1,2,5-oxadiazole-3-carboxamide |
| SMILES | Cc1nonc1C(=O)N/N=C/c1cn(Cc2ccc(Cl)cc2Cl)c2ccccc12 |
| InChI | InChI=1S/C20H15Cl2N5O2/c1-12-19(26-29-25-12)20(28)24-23-9-14-11-27(18-5-3-2-4-16(14)18)10-13-6-7-15(21)8-17(13)22/h2-9,11H,10H2,1H3,(H,24,28)/b23-9+ |
| InChIKey | WUQYWHWUAUQKLJ-NUGSKGIGSA-N |
| XLogP | 4.45 |
| TPSA | 85.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.28 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|