C28H26Cl2N4O3 — CID 126003342
ethyl N-[(1S)-3-[(2Z)-2-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]hydrazinyl]-3-oxo-1-phenylpropyl]carbamate (PubChem CID 126003342) has the molecular formula C28H26Cl2N4O3 and a molecular weight of 537.45 g/mol. Its IUPAC name is ethyl N-[(1S)-3-[(2Z)-2-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]hydrazinyl]-3-oxo-1-phenylpropyl]carbamate.
| Compound Name | ethyl N-[(1S)-3-[(2Z)-2-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]hydrazinyl]-3-oxo-1-phenylpropyl]carbamate |
|---|---|
| PubChem CID | 126003342 |
| Molecular Formula | C28H26Cl2N4O3 |
| Molecular Weight | 537.45 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | ethyl N-[(1S)-3-[(2Z)-2-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]hydrazinyl]-3-oxo-1-phenylpropyl]carbamate |
| SMILES | CCOC(=O)N[C@@H](CC(=O)N/N=C\c1cn(Cc2ccc(Cl)cc2Cl)c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C28H26Cl2N4O3/c1-2-37-28(36)32-25(19-8-4-3-5-9-19)15-27(35)33-31-16-21-18-34(26-11-7-6-10-23(21)26)17-20-12-13-22(29)14-24(20)30/h3-14,16,18,25H,2,15,17H2,1H3,(H,32,36)(H,33,35)/b31-16-/t25-/m0/s1 |
| InChIKey | AEUYANVUFKVHDM-MIIVUHEXSA-N |
| XLogP | 6.32 |
| TPSA | 84.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.45 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|