C17H14Cl2N6O2 — CID 135495390
1-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-2-nitroguanidine (PubChem CID 135495390) has the molecular formula C17H14Cl2N6O2 and a molecular weight of 405.25 g/mol. Its IUPAC name is 1-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-2-nitroguanidine.
| Compound Name | 1-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-2-nitroguanidine |
|---|---|
| PubChem CID | 135495390 |
| Molecular Formula | C17H14Cl2N6O2 |
| Molecular Weight | 405.25 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 1-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-2-nitroguanidine |
| SMILES | NC(=N[N+](=O)[O-])NN=Cc1cn(Cc2ccc(Cl)cc2Cl)c2ccccc12 |
| InChI | InChI=1S/C17H14Cl2N6O2/c18-13-6-5-11(15(19)7-13)9-24-10-12(14-3-1-2-4-16(14)24)8-21-22-17(20)23-25(26)27/h1-8,10H,9H2,(H3,20,22,23) |
| InChIKey | LWKKFTGBVLAHNB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 110.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.25 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|