C10H8ClN5O2 — CID 5368165
4-amino-N-[(Z)-(2-chlorophenyl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide (PubChem CID 5368165) has the molecular formula C10H8ClN5O2 and a molecular weight of 265.66 g/mol. Its IUPAC name is 4-amino-N-[(Z)-(2-chlorophenyl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | 4-amino-N-[(Z)-(2-chlorophenyl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 5368165 |
| Molecular Formula | C10H8ClN5O2 |
| Molecular Weight | 265.66 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 4-amino-N-[(Z)-(2-chlorophenyl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
| SMILES | Nc1nonc1C(=O)N/N=C\c1ccccc1Cl |
| InChI | InChI=1S/C10H8ClN5O2/c11-7-4-2-1-3-6(7)5-13-14-10(17)8-9(12)16-18-15-8/h1-5H,(H2,12,16)(H,14,17)/b13-5- |
| InChIKey | UVOMLBOQNYUYTK-ACAGNQJTSA-N |
| XLogP | 1.07 |
| TPSA | 106.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.66 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|