C10H9N5O3 — CID 5339905
4-amino-N-[(E)-(3-hydroxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide (PubChem CID 5339905) has the molecular formula C10H9N5O3 and a molecular weight of 247.21 g/mol. Its IUPAC name is 4-amino-N-[(E)-(3-hydroxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | 4-amino-N-[(E)-(3-hydroxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 5339905 |
| Molecular Formula | C10H9N5O3 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 4-amino-N-[(E)-(3-hydroxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
| SMILES | Nc1nonc1C(=O)N/N=C/c1cccc(O)c1 |
| InChI | InChI=1S/C10H9N5O3/c11-9-8(14-18-15-9)10(17)13-12-5-6-2-1-3-7(16)4-6/h1-5,16H,(H2,11,15)(H,13,17)/b12-5+ |
| InChIKey | OFSQWQPIBPWIHK-LFYBBSHMSA-N |
| XLogP | 0.12 |
| TPSA | 126.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|