C8H10N4O2 — CID 5380313
1-amino-3-[(Z)-(3-hydroxyphenyl)methylideneamino]urea (PubChem CID 5380313) has the molecular formula C8H10N4O2 and a molecular weight of 194.19 g/mol. Its IUPAC name is 1-amino-3-[(Z)-(3-hydroxyphenyl)methylideneamino]urea.
| Compound Name | 1-amino-3-[(Z)-(3-hydroxyphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 5380313 |
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 1-amino-3-[(Z)-(3-hydroxyphenyl)methylideneamino]urea |
| SMILES | NNC(=O)N/N=C\c1cccc(O)c1 |
| InChI | InChI=1S/C8H10N4O2/c9-11-8(14)12-10-5-6-2-1-3-7(13)4-6/h1-5,13H,9H2,(H2,11,12,14)/b10-5- |
| InChIKey | HYFHIDLHNNZKJR-YHYXMXQVSA-N |
| XLogP | -0.10 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|