C15H16N8O4 — CID 92884092
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(methoxymethyl)-N-[(E)-(3-methoxyphenyl)methylideneamino]triazole-4-carboxamide (PubChem CID 92884092) has the molecular formula C15H16N8O4 and a molecular weight of 372.35 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(methoxymethyl)-N-[(E)-(3-methoxyphenyl)methylideneamino]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(methoxymethyl)-N-[(E)-(3-methoxyphenyl)methylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 92884092 |
| Molecular Formula | C15H16N8O4 |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(methoxymethyl)-N-[(E)-(3-methoxyphenyl)methylideneamino]triazole-4-carboxamide |
| SMILES | COCc1c(C(=O)N/N=C/c2cccc(OC)c2)nnn1-c1nonc1N |
| InChI | InChI=1S/C15H16N8O4/c1-25-8-11-12(18-22-23(11)14-13(16)20-27-21-14)15(24)19-17-7-9-4-3-5-10(6-9)26-2/h3-7H,8H2,1-2H3,(H2,16,20)(H,19,24)/b17-7+ |
| InChIKey | NJURKDHOHQRCGO-REZTVBANSA-N |
| XLogP | 0.15 |
| TPSA | 155.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|