C27H25N9O3 — CID 6878177
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(anilinomethyl)-N-[(E)-[3-[(3-methylphenyl)methoxy]phenyl]methylideneamino]triazole-4-carboxamide (PubChem CID 6878177) has the molecular formula C27H25N9O3 and a molecular weight of 523.56 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(anilinomethyl)-N-[(E)-[3-[(3-methylphenyl)methoxy]phenyl]methylideneamino]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(anilinomethyl)-N-[(E)-[3-[(3-methylphenyl)methoxy]phenyl]methylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 6878177 |
| Molecular Formula | C27H25N9O3 |
| Molecular Weight | 523.56 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(anilinomethyl)-N-[(E)-[3-[(3-methylphenyl)methoxy]phenyl]methylideneamino]triazole-4-carboxamide |
| SMILES | Cc1cccc(COc2cccc(/C=N/NC(=O)c3nnn(-c4nonc4N)c3CNc3ccccc3)c2)c1 |
| InChI | InChI=1S/C27H25N9O3/c1-18-7-5-9-20(13-18)17-38-22-12-6-8-19(14-22)15-30-32-27(37)24-23(16-29-21-10-3-2-4-11-21)36(35-31-24)26-25(28)33-39-34-26/h2-15,29H,16-17H2,1H3,(H2,28,33)(H,32,37)/b30-15+ |
| InChIKey | LQDIMUGLBYDPQY-FJEPWZHXSA-N |
| XLogP | 3.50 |
| TPSA | 158.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.56 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|