C16H19N9O2 — CID 6374234
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(anilinomethyl)-N-[(Z)-butan-2-ylideneamino]triazole-4-carboxamide (PubChem CID 6374234) has the molecular formula C16H19N9O2 and a molecular weight of 369.39 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(anilinomethyl)-N-[(Z)-butan-2-ylideneamino]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(anilinomethyl)-N-[(Z)-butan-2-ylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 6374234 |
| Molecular Formula | C16H19N9O2 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(anilinomethyl)-N-[(Z)-butan-2-ylideneamino]triazole-4-carboxamide |
| SMILES | CC/C(C)=N\NC(=O)c1nnn(-c2nonc2N)c1CNc1ccccc1 |
| InChI | InChI=1S/C16H19N9O2/c1-3-10(2)19-21-16(26)13-12(9-18-11-7-5-4-6-8-11)25(24-20-13)15-14(17)22-27-23-15/h4-8,18H,3,9H2,1-2H3,(H2,17,22)(H,21,26)/b19-10- |
| InChIKey | WMPDXSRCNIWADF-GRSHGNNSSA-N |
| XLogP | 1.36 |
| TPSA | 149.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|