C15H15N9O4 — CID 5101703
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-(butan-2-ylideneamino)-5-(3-nitrophenyl)triazole-4-carboxamide (PubChem CID 5101703) has the molecular formula C15H15N9O4 and a molecular weight of 385.34 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-(butan-2-ylideneamino)-5-(3-nitrophenyl)triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-(butan-2-ylideneamino)-5-(3-nitrophenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 5101703 |
| Molecular Formula | C15H15N9O4 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-(butan-2-ylideneamino)-5-(3-nitrophenyl)triazole-4-carboxamide |
| SMILES | CCC(C)=NNC(=O)c1nnn(-c2nonc2N)c1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H15N9O4/c1-3-8(2)17-19-15(25)11-12(9-5-4-6-10(7-9)24(26)27)23(22-18-11)14-13(16)20-28-21-14/h4-7H,3H2,1-2H3,(H2,16,20)(H,19,25) |
| InChIKey | HECRDJMSNUCLLC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 180.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|