C19H14N10O6 — CID 5201648
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(4-nitrophenyl)-N-[1-(4-nitrophenyl)ethylideneamino]triazole-4-carboxamide (PubChem CID 5201648) has the molecular formula C19H14N10O6 and a molecular weight of 478.39 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(4-nitrophenyl)-N-[1-(4-nitrophenyl)ethylideneamino]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(4-nitrophenyl)-N-[1-(4-nitrophenyl)ethylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 5201648 |
| Molecular Formula | C19H14N10O6 |
| Molecular Weight | 478.39 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(4-nitrophenyl)-N-[1-(4-nitrophenyl)ethylideneamino]triazole-4-carboxamide |
| SMILES | CC(=NNC(=O)c1nnn(-c2nonc2N)c1-c1ccc([N+](=O)[O-])cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H14N10O6/c1-10(11-2-6-13(7-3-11)28(31)32)21-23-19(30)15-16(12-4-8-14(9-5-12)29(33)34)27(26-22-15)18-17(20)24-35-25-18/h2-9H,1H3,(H2,20,24)(H,23,30) |
| InChIKey | IOLHZMYMCHNHQD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 223.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|