C17H12N10O4 — CID 6869709
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(4-nitrophenyl)-N-[(E)-pyridin-4-ylmethylideneamino]triazole-4-carboxamide (PubChem CID 6869709) has the molecular formula C17H12N10O4 and a molecular weight of 420.35 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(4-nitrophenyl)-N-[(E)-pyridin-4-ylmethylideneamino]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(4-nitrophenyl)-N-[(E)-pyridin-4-ylmethylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 6869709 |
| Molecular Formula | C17H12N10O4 |
| Molecular Weight | 420.35 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(4-nitrophenyl)-N-[(E)-pyridin-4-ylmethylideneamino]triazole-4-carboxamide |
| SMILES | Nc1nonc1-n1nnc(C(=O)N/N=C/c2ccncc2)c1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H12N10O4/c18-15-16(24-31-23-15)26-14(11-1-3-12(4-2-11)27(29)30)13(21-25-26)17(28)22-20-9-10-5-7-19-8-6-10/h1-9H,(H2,18,23)(H,22,28)/b20-9+ |
| InChIKey | SJNVOGZCABNIGZ-AWQFTUOYSA-N |
| XLogP | 0.97 |
| TPSA | 193.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.35 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|