C18H11I2N9O5 — CID 3456439
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]-5-(4-nitrophenyl)triazole-4-carboxamide (PubChem CID 3456439) has the molecular formula C18H11I2N9O5 and a molecular weight of 687.15 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]-5-(4-nitrophenyl)triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]-5-(4-nitrophenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 3456439 |
| Molecular Formula | C18H11I2N9O5 |
| Molecular Weight | 687.15 g/mol |
| Exact Mass | 686.90 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]-5-(4-nitrophenyl)triazole-4-carboxamide |
| SMILES | Nc1nonc1-n1nnc(C(=O)NN=Cc2cc(I)cc(I)c2O)c1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H11I2N9O5/c19-10-5-9(15(30)12(20)6-10)7-22-24-18(31)13-14(8-1-3-11(4-2-8)29(32)33)28(27-23-13)17-16(21)25-34-26-17/h1-7,30H,(H2,21,25)(H,24,31) |
| InChIKey | ITAAEIURBDDCNF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 200.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.15 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|