C20H17N9O5 — CID 6868927
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(2-ethoxyphenyl)methylideneamino]-5-(4-nitrophenyl)triazole-4-carboxamide (PubChem CID 6868927) has the molecular formula C20H17N9O5 and a molecular weight of 463.41 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(2-ethoxyphenyl)methylideneamino]-5-(4-nitrophenyl)triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(2-ethoxyphenyl)methylideneamino]-5-(4-nitrophenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 6868927 |
| Molecular Formula | C20H17N9O5 |
| Molecular Weight | 463.41 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(2-ethoxyphenyl)methylideneamino]-5-(4-nitrophenyl)triazole-4-carboxamide |
| SMILES | CCOc1ccccc1/C=N/NC(=O)c1nnn(-c2nonc2N)c1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H17N9O5/c1-2-33-15-6-4-3-5-13(15)11-22-24-20(30)16-17(12-7-9-14(10-8-12)29(31)32)28(27-23-16)19-18(21)25-34-26-19/h3-11H,2H2,1H3,(H2,21,25)(H,24,30)/b22-11+ |
| InChIKey | QYTIXYKDDMFKIO-SSDVNMTOSA-N |
| XLogP | 1.97 |
| TPSA | 189.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|