C17H20N8O3 — CID 2042790
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(2-ethoxyphenyl)methylideneamino]-5-propyltriazole-4-carboxamide (PubChem CID 2042790) has the molecular formula C17H20N8O3 and a molecular weight of 384.40 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(2-ethoxyphenyl)methylideneamino]-5-propyltriazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(2-ethoxyphenyl)methylideneamino]-5-propyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 2042790 |
| Molecular Formula | C17H20N8O3 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(2-ethoxyphenyl)methylideneamino]-5-propyltriazole-4-carboxamide |
| SMILES | CCCc1c(C(=O)NN=Cc2ccccc2OCC)nnn1-c1nonc1N |
| InChI | InChI=1S/C17H20N8O3/c1-3-7-12-14(20-24-25(12)16-15(18)22-28-23-16)17(26)21-19-10-11-8-5-6-9-13(11)27-4-2/h5-6,8-10H,3-4,7H2,1-2H3,(H2,18,22)(H,21,26) |
| InChIKey | UIRPCHVQJWWUFG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 146.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|