C21H29N9O3 — CID 46500251
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(dipropylamino)methyl]-N-[(E)-(2-ethoxyphenyl)methylideneamino]triazole-4-carboxamide (PubChem CID 46500251) has the molecular formula C21H29N9O3 and a molecular weight of 455.52 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(dipropylamino)methyl]-N-[(E)-(2-ethoxyphenyl)methylideneamino]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(dipropylamino)methyl]-N-[(E)-(2-ethoxyphenyl)methylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 46500251 |
| Molecular Formula | C21H29N9O3 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(dipropylamino)methyl]-N-[(E)-(2-ethoxyphenyl)methylideneamino]triazole-4-carboxamide |
| SMILES | CCCN(CCC)Cc1c(C(=O)N/N=C/c2ccccc2OCC)nnn1-c1nonc1N |
| InChI | InChI=1S/C21H29N9O3/c1-4-11-29(12-5-2)14-16-18(24-28-30(16)20-19(22)26-33-27-20)21(31)25-23-13-15-9-7-8-10-17(15)32-6-3/h7-10,13H,4-6,11-12,14H2,1-3H3,(H2,22,26)(H,25,31)/b23-13+ |
| InChIKey | HHVZGRBENMPWCM-YDZHTSKRSA-N |
| XLogP | 2.02 |
| TPSA | 149.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|