C22H31N9O5 — CID 92650895
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(dipropylamino)methyl]-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]triazole-4-carboxamide (PubChem CID 92650895) has the molecular formula C22H31N9O5 and a molecular weight of 501.55 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(dipropylamino)methyl]-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(dipropylamino)methyl]-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 92650895 |
| Molecular Formula | C22H31N9O5 |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(dipropylamino)methyl]-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]triazole-4-carboxamide |
| SMILES | CCCN(CCC)Cc1c(C(=O)N/N=C\c2cc(OC)c(OC)c(OC)c2)nnn1-c1nonc1N |
| InChI | InChI=1S/C22H31N9O5/c1-6-8-30(9-7-2)13-15-18(25-29-31(15)21-20(23)27-36-28-21)22(32)26-24-12-14-10-16(33-3)19(35-5)17(11-14)34-4/h10-12H,6-9,13H2,1-5H3,(H2,23,27)(H,26,32)/b24-12- |
| InChIKey | QZIWSQMUUIAIDL-MSXFZWOLSA-N |
| XLogP | 1.64 |
| TPSA | 168.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|