C25H23N9O3 — CID 3339183
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(2-methoxynaphthalen-1-yl)methylideneamino]-5-[(N-methylanilino)methyl]triazole-4-carboxamide (PubChem CID 3339183) has the molecular formula C25H23N9O3 and a molecular weight of 497.52 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(2-methoxynaphthalen-1-yl)methylideneamino]-5-[(N-methylanilino)methyl]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(2-methoxynaphthalen-1-yl)methylideneamino]-5-[(N-methylanilino)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 3339183 |
| Molecular Formula | C25H23N9O3 |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(2-methoxynaphthalen-1-yl)methylideneamino]-5-[(N-methylanilino)methyl]triazole-4-carboxamide |
| SMILES | COc1ccc2ccccc2c1C=NNC(=O)c1nnn(-c2nonc2N)c1CN(C)c1ccccc1 |
| InChI | InChI=1S/C25H23N9O3/c1-33(17-9-4-3-5-10-17)15-20-22(28-32-34(20)24-23(26)30-37-31-24)25(35)29-27-14-19-18-11-7-6-8-16(18)12-13-21(19)36-2/h3-14H,15H2,1-2H3,(H2,26,30)(H,29,35) |
| InChIKey | BVJPEUADSQAGGL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 149.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|