C17H20N8O5 — CID 4623433
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-ethyl-N-[(3,4,5-trimethoxyphenyl)methylideneamino]triazole-4-carboxamide (PubChem CID 4623433) has the molecular formula C17H20N8O5 and a molecular weight of 416.40 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-ethyl-N-[(3,4,5-trimethoxyphenyl)methylideneamino]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-ethyl-N-[(3,4,5-trimethoxyphenyl)methylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 4623433 |
| Molecular Formula | C17H20N8O5 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-ethyl-N-[(3,4,5-trimethoxyphenyl)methylideneamino]triazole-4-carboxamide |
| SMILES | CCc1c(C(=O)NN=Cc2cc(OC)c(OC)c(OC)c2)nnn1-c1nonc1N |
| InChI | InChI=1S/C17H20N8O5/c1-5-10-13(20-24-25(10)16-15(18)22-30-23-16)17(26)21-19-8-9-6-11(27-2)14(29-4)12(7-9)28-3/h6-8H,5H2,1-4H3,(H2,18,22)(H,21,26) |
| InChIKey | HIJPZANOWSUEFM-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 164.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|