C22H30N8O3 — CID 135721440
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-5-ethyltriazole-4-carboxamide (PubChem CID 135721440) has the molecular formula C22H30N8O3 and a molecular weight of 454.54 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-5-ethyltriazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-5-ethyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 135721440 |
| Molecular Formula | C22H30N8O3 |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-5-ethyltriazole-4-carboxamide |
| SMILES | CCc1c(C(=O)N/N=C/c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)nnn1-c1nonc1N |
| InChI | InChI=1S/C22H30N8O3/c1-8-15-16(25-29-30(15)19-18(23)27-33-28-19)20(32)26-24-11-12-9-13(21(2,3)4)17(31)14(10-12)22(5,6)7/h9-11,31H,8H2,1-7H3,(H2,23,27)(H,26,32)/b24-11+ |
| InChIKey | RDONKDSTGOIPLZ-BHGWPJFGSA-N |
| XLogP | 2.86 |
| TPSA | 157.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|