C23H34N9O3+ — CID 135659359
[3-(4-amino-1,2,5-oxadiazol-3-yl)-5-[[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]carbamoyl]triazol-4-yl]methyl-dimethylazanium (PubChem CID 135659359) has the molecular formula C23H34N9O3+ and a molecular weight of 484.59 g/mol. Its IUPAC name is [3-(4-amino-1,2,5-oxadiazol-3-yl)-5-[[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]carbamoyl]triazol-4-yl]methyl-dimethylazanium.
| Compound Name | [3-(4-amino-1,2,5-oxadiazol-3-yl)-5-[[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]carbamoyl]triazol-4-yl]methyl-dimethylazanium |
|---|---|
| PubChem CID | 135659359 |
| Molecular Formula | C23H34N9O3+ |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | [3-(4-amino-1,2,5-oxadiazol-3-yl)-5-[[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]carbamoyl]triazol-4-yl]methyl-dimethylazanium |
| SMILES | C[NH+](C)Cc1c(C(=O)N/N=C/c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)nnn1-c1nonc1N |
| InChI | InChI=1S/C23H33N9O3/c1-22(2,3)14-9-13(10-15(18(14)33)23(4,5)6)11-25-27-21(34)17-16(12-31(7)8)32(30-26-17)20-19(24)28-35-29-20/h9-11,33H,12H2,1-8H3,(H2,24,28)(H,27,34)/p+1/b25-11+ |
| InChIKey | YNJXZINHPHOZAX-OPEKNORGSA-O |
| XLogP | 0.94 |
| TPSA | 161.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|