C18H22N10O4 — CID 135909200
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(3,4-dihydroxyphenyl)methylideneamino]-5-[(4-methylpiperazin-1-yl)methyl]triazole-4-carboxamide (PubChem CID 135909200) has the molecular formula C18H22N10O4 and a molecular weight of 442.44 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(3,4-dihydroxyphenyl)methylideneamino]-5-[(4-methylpiperazin-1-yl)methyl]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(3,4-dihydroxyphenyl)methylideneamino]-5-[(4-methylpiperazin-1-yl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 135909200 |
| Molecular Formula | C18H22N10O4 |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(3,4-dihydroxyphenyl)methylideneamino]-5-[(4-methylpiperazin-1-yl)methyl]triazole-4-carboxamide |
| SMILES | CN1CCN(Cc2c(C(=O)N/N=C\c3ccc(O)c(O)c3)nnn2-c2nonc2N)CC1 |
| InChI | InChI=1S/C18H22N10O4/c1-26-4-6-27(7-5-26)10-12-15(21-25-28(12)17-16(19)23-32-24-17)18(31)22-20-9-11-2-3-13(29)14(30)8-11/h2-3,8-9,29-30H,4-7,10H2,1H3,(H2,19,23)(H,22,31)/b20-9- |
| InChIKey | MXFKZMYFLGKSJA-UKWGHVSLSA-N |
| XLogP | -0.85 |
| TPSA | 184.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|