C26H29N9O2 — CID 6082389
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(4-benzylpiperidin-1-yl)methyl]-N-[(Z)-(4-methylphenyl)methylideneamino]triazole-4-carboxamide (PubChem CID 6082389) has the molecular formula C26H29N9O2 and a molecular weight of 499.58 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(4-benzylpiperidin-1-yl)methyl]-N-[(Z)-(4-methylphenyl)methylideneamino]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(4-benzylpiperidin-1-yl)methyl]-N-[(Z)-(4-methylphenyl)methylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 6082389 |
| Molecular Formula | C26H29N9O2 |
| Molecular Weight | 499.58 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(4-benzylpiperidin-1-yl)methyl]-N-[(Z)-(4-methylphenyl)methylideneamino]triazole-4-carboxamide |
| SMILES | Cc1ccc(/C=N\NC(=O)c2nnn(-c3nonc3N)c2CN2CCC(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H29N9O2/c1-18-7-9-21(10-8-18)16-28-30-26(36)23-22(35(33-29-23)25-24(27)31-37-32-25)17-34-13-11-20(12-14-34)15-19-5-3-2-4-6-19/h2-10,16,20H,11-15,17H2,1H3,(H2,27,31)(H,30,36)/b28-16- |
| InChIKey | CWGBMQNIAZNGDV-NTFVMDSBSA-N |
| XLogP | 2.76 |
| TPSA | 140.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.58 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|