C19H22BrN9O3 — CID 5186650
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-5-[(4-methylpiperidin-1-yl)methyl]triazole-4-carboxamide (PubChem CID 5186650) has the molecular formula C19H22BrN9O3 and a molecular weight of 504.35 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-5-[(4-methylpiperidin-1-yl)methyl]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-5-[(4-methylpiperidin-1-yl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 5186650 |
| Molecular Formula | C19H22BrN9O3 |
| Molecular Weight | 504.35 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-5-[(4-methylpiperidin-1-yl)methyl]triazole-4-carboxamide |
| SMILES | CC1CCN(Cc2c(C(=O)NN=Cc3cc(Br)ccc3O)nnn2-c2nonc2N)CC1 |
| InChI | InChI=1S/C19H22BrN9O3/c1-11-4-6-28(7-5-11)10-14-16(23-27-29(14)18-17(21)25-32-26-18)19(31)24-22-9-12-8-13(20)2-3-15(12)30/h2-3,8-9,11,30H,4-7,10H2,1H3,(H2,21,25)(H,24,31) |
| InChIKey | HVORMKASIWAKGX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 160.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.35 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|